C18H21F2N — CID 43100376
N-[1-(4-tert-butylphenyl)ethyl]-3,5-difluoroaniline (PubChem CID 43100376) has the molecular formula C18H21F2N and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-3,5-difluoroaniline.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 43100376 |
| Molecular Formula | C18H21F2N |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-3,5-difluoroaniline |
| SMILES | CC(Nc1cc(F)cc(F)c1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21F2N/c1-12(21-17-10-15(19)9-16(20)11-17)13-5-7-14(8-6-13)18(2,3)4/h5-12,21H,1-4H3 |
| InChIKey | CHJMCGGBIGCFJX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |