About 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane
4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane (PubChem CID 167597464) has the molecular formula C19H24FN3O2
and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane.
Molecular Properties
| Compound Name | 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane |
| PubChem CID | 167597464 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane |
| SMILES | C.C.Cc1nc(N[C@H](C)c2ccc(F)cc2)c2cc(O)c(O)cc2n1 |
| InChI | InChI=1S/C17H16FN3O2.2CH4/c1-9(11-3-5-12(18)6-4-11)19-17-13-7-15(22)16(23)8-14(13)20-10(2)21-17;;/h3-9,22-23H,1-2H3,(H,19,20,21);2*1H4/t9-;;/m1../s1 |
| InChIKey | JGSWPKPARDHIRM-KLQYNRQASA-N |
| XLogP | 4.93 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane?
The IUPAC name of 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane (CID 167597464) is 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane.
What is the SMILES notation for 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane?
The canonical SMILES for 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane is C.C.Cc1nc(N[C@H](C)c2ccc(F)cc2)c2cc(O)c(O)cc2n1.
What is the InChIKey of 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane?
The InChIKey is JGSWPKPARDHIRM-KLQYNRQASA-N. The full InChI is InChI=1S/C17H16FN3O2.2CH4/c1-9(11-3-5-12(18)6-4-11)19-17-13-7-15(22)16(23)8-14(13)20-10(2)21-17;;/h3-9,22-23H,1-2H3,(H,19,20,21);2*1H4/t9-;;/m1../s1.
What are the key properties of 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane?
4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane has a molecular weight of 345.42 g/mol, XLogP of 4.93, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane is sourced from PubChem (CID 167597464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).