C19H24FN3O2 — CID 167597464
4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane (PubChem CID 167597464) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane.
| Compound Name | 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane |
|---|---|
| PubChem CID | 167597464 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-2-methylquinazoline-6,7-diol;methane |
| SMILES | C.C.Cc1nc(N[C@H](C)c2ccc(F)cc2)c2cc(O)c(O)cc2n1 |
| InChI | InChI=1S/C17H16FN3O2.2CH4/c1-9(11-3-5-12(18)6-4-11)19-17-13-7-15(22)16(23)8-14(13)20-10(2)21-17;;/h3-9,22-23H,1-2H3,(H,19,20,21);2*1H4/t9-;;/m1../s1 |
| InChIKey | JGSWPKPARDHIRM-KLQYNRQASA-N |
| XLogP | 4.93 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|