C20H19N3O4 — CID 142432954
4-[1-(7-hydroxy-1-benzofuran-2-yl)ethylamino]-7-methoxy-2-methylquinazolin-6-ol (PubChem CID 142432954) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[1-(7-hydroxy-1-benzofuran-2-yl)ethylamino]-7-methoxy-2-methylquinazolin-6-ol.
| Compound Name | 4-[1-(7-hydroxy-1-benzofuran-2-yl)ethylamino]-7-methoxy-2-methylquinazolin-6-ol |
|---|---|
| PubChem CID | 142432954 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[1-(7-hydroxy-1-benzofuran-2-yl)ethylamino]-7-methoxy-2-methylquinazolin-6-ol |
| SMILES | COc1cc2nc(C)nc(NC(C)c3cc4cccc(O)c4o3)c2cc1O |
| InChI | InChI=1S/C20H19N3O4/c1-10(17-7-12-5-4-6-15(24)19(12)27-17)21-20-13-8-16(25)18(26-3)9-14(13)22-11(2)23-20/h4-10,24-25H,1-3H3,(H,21,22,23) |
| InChIKey | AQYVYFGAOFXZNA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |