C18H22N6 — CID 167137432
4-N-[1-(3,5-diaminophenyl)ethyl]-6-N,2-dimethylquinazoline-4,6-diamine (PubChem CID 167137432) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 4-N-[1-(3,5-diaminophenyl)ethyl]-6-N,2-dimethylquinazoline-4,6-diamine.
| Compound Name | 4-N-[1-(3,5-diaminophenyl)ethyl]-6-N,2-dimethylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 167137432 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 4-N-[1-(3,5-diaminophenyl)ethyl]-6-N,2-dimethylquinazoline-4,6-diamine |
| SMILES | CNc1ccc2nc(C)nc(NC(C)c3cc(N)cc(N)c3)c2c1 |
| InChI | InChI=1S/C18H22N6/c1-10(12-6-13(19)8-14(20)7-12)22-18-16-9-15(21-3)4-5-17(16)23-11(2)24-18/h4-10,21H,19-20H2,1-3H3,(H,22,23,24) |
| InChIKey | UYCYQCCAFJFNPK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|