C23H26F3N5O — CID 156537225
N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-amine (PubChem CID 156537225) has the molecular formula C23H26F3N5O and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-amine.
| Compound Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-amine |
|---|---|
| PubChem CID | 156537225 |
| Molecular Formula | C23H26F3N5O |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc3c(cc2n1)OC(C)(C)CN3C |
| InChI | InChI=1S/C23H26F3N5O/c1-12(14-6-15(23(24,25)26)8-16(27)7-14)28-21-17-9-19-20(10-18(17)29-13(2)30-21)32-22(3,4)11-31(19)5/h6-10,12H,11,27H2,1-5H3,(H,28,29,30)/t12-/m1/s1 |
| InChIKey | VHVBPONCBQFXQB-GFCCVEGCSA-N |
| XLogP | 5.32 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|