C24H25F3N4O4 — CID 164562231
(3S,7R)-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-16-methyl-2,5,8,11-tetraoxa-15,17-diazatetracyclo[10.8.0.03,7.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine (PubChem CID 164562231) has the molecular formula C24H25F3N4O4 and a molecular weight of 490.48 g/mol. Its IUPAC name is (3S,7R)-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-16-methyl-2,5,8,11-tetraoxa-15,17-diazatetracyclo[10.8.0.03,7.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine.
| Compound Name | (3S,7R)-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-16-methyl-2,5,8,11-tetraoxa-15,17-diazatetracyclo[10.8.0.03,7.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine |
|---|---|
| PubChem CID | 164562231 |
| Molecular Formula | C24H25F3N4O4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (3S,7R)-N-[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-16-methyl-2,5,8,11-tetraoxa-15,17-diazatetracyclo[10.8.0.03,7.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc3c(cc2n1)OCCO[C@@H]1COC[C@@H]1O3 |
| InChI | InChI=1S/C24H25F3N4O4/c1-12(14-5-15(24(25,26)27)7-16(28)6-14)29-23-17-8-20-19(9-18(17)30-13(2)31-23)33-3-4-34-21-10-32-11-22(21)35-20/h5-9,12,21-22H,3-4,10-11,28H2,1-2H3,(H,29,30,31)/t12-,21-,22+/m1/s1 |
| InChIKey | ICMPHCIQSYYMQD-WLERDACDSA-N |
| XLogP | 4.27 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|