C24H27F3N4O2 — CID 156547605
2,2-difluoro-2-[2-fluoro-3-[(1R)-1-[(2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]ethanol (PubChem CID 156547605) has the molecular formula C24H27F3N4O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 2,2-difluoro-2-[2-fluoro-3-[(1R)-1-[(2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]ethanol.
| Compound Name | 2,2-difluoro-2-[2-fluoro-3-[(1R)-1-[(2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]ethanol |
|---|---|
| PubChem CID | 156547605 |
| Molecular Formula | C24H27F3N4O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2,2-difluoro-2-[2-fluoro-3-[(1R)-1-[(2,6,8,8-tetramethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-4-yl)amino]ethyl]phenyl]ethanol |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)(F)CO)c2F)c2cc3c(cc2n1)OC(C)(C)CN3C |
| InChI | InChI=1S/C24H27F3N4O2/c1-13(15-7-6-8-17(21(15)25)24(26,27)12-32)28-22-16-9-19-20(10-18(16)29-14(2)30-22)33-23(3,4)11-31(19)5/h6-10,13,32H,11-12H2,1-5H3,(H,28,29,30)/t13-/m1/s1 |
| InChIKey | QXNQTOUXWWDTOQ-CYBMUJFWSA-N |
| XLogP | 4.94 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |