C27H31F3N4O2 — CID 156537604
4-[1-[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]ethylamino]-2,6,9,9-tetramethyl-8H-pyrido[2,3-g]quinazolin-7-one (PubChem CID 156537604) has the molecular formula C27H31F3N4O2 and a molecular weight of 500.57 g/mol. Its IUPAC name is 4-[1-[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]ethylamino]-2,6,9,9-tetramethyl-8H-pyrido[2,3-g]quinazolin-7-one.
| Compound Name | 4-[1-[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]ethylamino]-2,6,9,9-tetramethyl-8H-pyrido[2,3-g]quinazolin-7-one |
|---|---|
| PubChem CID | 156537604 |
| Molecular Formula | C27H31F3N4O2 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 4-[1-[3-(1,1-difluoro-2-hydroxy-2-methylpropyl)-2-fluorophenyl]ethylamino]-2,6,9,9-tetramethyl-8H-pyrido[2,3-g]quinazolin-7-one |
| SMILES | Cc1nc(NC(C)c2cccc(C(F)(F)C(C)(C)O)c2F)c2cc3c(cc2n1)C(C)(C)CC(=O)N3C |
| InChI | InChI=1S/C27H31F3N4O2/c1-14(16-9-8-10-18(23(16)28)27(29,30)26(5,6)36)31-24-17-11-21-19(12-20(17)32-15(2)33-24)25(3,4)13-22(35)34(21)7/h8-12,14,36H,13H2,1-7H3,(H,31,32,33) |
| InChIKey | VVNHYNDZXZUWAO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |