C18H18ClN3O — CID 163250679
[4-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-methylquinazolin-6-yl]methanol (PubChem CID 163250679) has the molecular formula C18H18ClN3O and a molecular weight of 327.82 g/mol. Its IUPAC name is [4-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-methylquinazolin-6-yl]methanol.
| Compound Name | [4-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-methylquinazolin-6-yl]methanol |
|---|---|
| PubChem CID | 163250679 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [4-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-methylquinazolin-6-yl]methanol |
| SMILES | Cc1nc(N[C@H](C)c2cccc(Cl)c2)c2cc(CO)ccc2n1 |
| InChI | InChI=1S/C18H18ClN3O/c1-11(14-4-3-5-15(19)9-14)20-18-16-8-13(10-23)6-7-17(16)21-12(2)22-18/h3-9,11,23H,10H2,1-2H3,(H,20,21,22)/t11-/m1/s1 |
| InChIKey | BZPGKKHBBMGITH-LLVKDONJSA-N |
| XLogP | 4.26 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |