C18H18ClN3 — CID 135336392
N-[1-(3-chlorophenyl)ethyl]-2,6-dimethylquinazolin-4-amine (PubChem CID 135336392) has the molecular formula C18H18ClN3 and a molecular weight of 311.82 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-2,6-dimethylquinazolin-4-amine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-2,6-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 135336392 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-2,6-dimethylquinazolin-4-amine |
| SMILES | Cc1ccc2nc(C)nc(NC(C)c3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C18H18ClN3/c1-11-7-8-17-16(9-11)18(22-13(3)21-17)20-12(2)14-5-4-6-15(19)10-14/h4-10,12H,1-3H3,(H,20,21,22) |
| InChIKey | MVUSMIMLHTXBMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |