C18H16N4 — CID 99812363
3-[(1R)-1-[(6-methylquinazolin-4-yl)amino]ethyl]benzonitrile (PubChem CID 99812363) has the molecular formula C18H16N4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[(1R)-1-[(6-methylquinazolin-4-yl)amino]ethyl]benzonitrile.
| Compound Name | 3-[(1R)-1-[(6-methylquinazolin-4-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 99812363 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-[(1R)-1-[(6-methylquinazolin-4-yl)amino]ethyl]benzonitrile |
| SMILES | Cc1ccc2ncnc(N[C@H](C)c3cccc(C#N)c3)c2c1 |
| InChI | InChI=1S/C18H16N4/c1-12-6-7-17-16(8-12)18(21-11-20-17)22-13(2)15-5-3-4-14(9-15)10-19/h3-9,11,13H,1-2H3,(H,20,21,22)/t13-/m1/s1 |
| InChIKey | TVEQKGVYRYUUIS-CYBMUJFWSA-N |
| XLogP | 3.98 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |