C16H13N5 — CID 133333103
3-[1-(pyrido[2,3-b]pyrazin-6-ylamino)ethyl]benzonitrile (PubChem CID 133333103) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[1-(pyrido[2,3-b]pyrazin-6-ylamino)ethyl]benzonitrile.
| Compound Name | 3-[1-(pyrido[2,3-b]pyrazin-6-ylamino)ethyl]benzonitrile |
|---|---|
| PubChem CID | 133333103 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[1-(pyrido[2,3-b]pyrazin-6-ylamino)ethyl]benzonitrile |
| SMILES | CC(Nc1ccc2nccnc2n1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H13N5/c1-11(13-4-2-3-12(9-13)10-17)20-15-6-5-14-16(21-15)19-8-7-18-14/h2-9,11H,1H3,(H,19,20,21) |
| InChIKey | GULDSFJTPHYBGK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |