C17H13FN4 — CID 99812367
3-[(1R)-1-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile (PubChem CID 99812367) has the molecular formula C17H13FN4 and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-[(1R)-1-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile.
| Compound Name | 3-[(1R)-1-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 99812367 |
| Molecular Formula | C17H13FN4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[(1R)-1-[(6-fluoroquinazolin-4-yl)amino]ethyl]benzonitrile |
| SMILES | C[C@@H](Nc1ncnc2ccc(F)cc12)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H13FN4/c1-11(13-4-2-3-12(7-13)9-19)22-17-15-8-14(18)5-6-16(15)20-10-21-17/h2-8,10-11H,1H3,(H,20,21,22)/t11-/m1/s1 |
| InChIKey | YSVSHETUTBLADU-LLVKDONJSA-N |
| XLogP | 3.81 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |