C22H19ClFN5S — CID 164556435
6-[6-chloro-5-(methylsulfanylamino)-3-pyridinyl]-N-[1-(3-fluorophenyl)ethyl]quinazolin-4-amine (PubChem CID 164556435) has the molecular formula C22H19ClFN5S and a molecular weight of 439.95 g/mol. Its IUPAC name is 6-[6-chloro-5-(methylsulfanylamino)-3-pyridinyl]-N-[1-(3-fluorophenyl)ethyl]quinazolin-4-amine.
| Compound Name | 6-[6-chloro-5-(methylsulfanylamino)-3-pyridinyl]-N-[1-(3-fluorophenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 164556435 |
| Molecular Formula | C22H19ClFN5S |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 6-[6-chloro-5-(methylsulfanylamino)-3-pyridinyl]-N-[1-(3-fluorophenyl)ethyl]quinazolin-4-amine |
| SMILES | CSNc1cc(-c2ccc3ncnc(NC(C)c4cccc(F)c4)c3c2)cnc1Cl |
| InChI | InChI=1S/C22H19ClFN5S/c1-13(14-4-3-5-17(24)8-14)28-22-18-9-15(6-7-19(18)26-12-27-22)16-10-20(29-30-2)21(23)25-11-16/h3-13,29H,1-2H3,(H,26,27,28) |
| InChIKey | AMAYFMCRYLMEBH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|