C21H19N5 — CID 164556375
6-(5-amino-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine (PubChem CID 164556375) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 6-(5-amino-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine.
| Compound Name | 6-(5-amino-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 164556375 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 6-(5-amino-3-pyridinyl)-N-(1-phenylethyl)quinazolin-4-amine |
| SMILES | CC(Nc1ncnc2ccc(-c3cncc(N)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C21H19N5/c1-14(15-5-3-2-4-6-15)26-21-19-10-16(7-8-20(19)24-13-25-21)17-9-18(22)12-23-11-17/h2-14H,22H2,1H3,(H,24,25,26) |
| InChIKey | WATBKQDMDMLYFF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |