C24H21N7 — CID 164556578
6-[5-(1-methyltriazol-4-yl)-3-pyridinyl]-N-[(1R)-1-phenylethyl]quinazolin-4-amine (PubChem CID 164556578) has the molecular formula C24H21N7 and a molecular weight of 407.48 g/mol. Its IUPAC name is 6-[5-(1-methyltriazol-4-yl)-3-pyridinyl]-N-[(1R)-1-phenylethyl]quinazolin-4-amine.
| Compound Name | 6-[5-(1-methyltriazol-4-yl)-3-pyridinyl]-N-[(1R)-1-phenylethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 164556578 |
| Molecular Formula | C24H21N7 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 6-[5-(1-methyltriazol-4-yl)-3-pyridinyl]-N-[(1R)-1-phenylethyl]quinazolin-4-amine |
| SMILES | C[C@@H](Nc1ncnc2ccc(-c3cncc(-c4cn(C)nn4)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C24H21N7/c1-16(17-6-4-3-5-7-17)28-24-21-11-18(8-9-22(21)26-15-27-24)19-10-20(13-25-12-19)23-14-31(2)30-29-23/h3-16H,1-2H3,(H,26,27,28)/t16-/m1/s1 |
| InChIKey | QSNJEIAPYZDBSO-MRXNPFEDSA-N |
| XLogP | 4.66 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |