C18H17F2N3O2 — CID 146131899
6-fluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]quinazolin-4-amine (PubChem CID 146131899) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 6-fluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]quinazolin-4-amine.
| Compound Name | 6-fluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146131899 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 6-fluoro-N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]quinazolin-4-amine |
| SMILES | COc1cc(F)c(C(C)Nc2ncnc3ccc(F)cc23)cc1OC |
| InChI | InChI=1S/C18H17F2N3O2/c1-10(12-7-16(24-2)17(25-3)8-14(12)20)23-18-13-6-11(19)4-5-15(13)21-9-22-18/h4-10H,1-3H3,(H,21,22,23) |
| InChIKey | MLLMOIZUGOVVPW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |