C17H12F2N4 — CID 99812358
3-[(1S)-1-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]benzonitrile (PubChem CID 99812358) has the molecular formula C17H12F2N4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 3-[(1S)-1-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]benzonitrile.
| Compound Name | 3-[(1S)-1-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 99812358 |
| Molecular Formula | C17H12F2N4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-[(1S)-1-[(6,7-difluoroquinazolin-4-yl)amino]ethyl]benzonitrile |
| SMILES | C[C@H](Nc1ncnc2cc(F)c(F)cc12)c1cccc(C#N)c1 |
| InChI | InChI=1S/C17H12F2N4/c1-10(12-4-2-3-11(5-12)8-20)23-17-13-6-14(18)15(19)7-16(13)21-9-22-17/h2-7,9-10H,1H3,(H,21,22,23)/t10-/m0/s1 |
| InChIKey | SMZSZTRKUFYVFX-JTQLQIEISA-N |
| XLogP | 3.95 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |