C29H27F3N6O2 — CID 175415644
[7-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylquinazolin-6-yl]-2-(dimethylamino)indolizin-5-yl] formate (PubChem CID 175415644) has the molecular formula C29H27F3N6O2 and a molecular weight of 548.57 g/mol. Its IUPAC name is [7-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylquinazolin-6-yl]-2-(dimethylamino)indolizin-5-yl] formate.
| Compound Name | [7-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylquinazolin-6-yl]-2-(dimethylamino)indolizin-5-yl] formate |
|---|---|
| PubChem CID | 175415644 |
| Molecular Formula | C29H27F3N6O2 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [7-[4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-2-methylquinazolin-6-yl]-2-(dimethylamino)indolizin-5-yl] formate |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2)c2cc(-c3cc(OC=O)n4cc(N(C)C)cc4c3)ccc2n1 |
| InChI | InChI=1S/C29H27F3N6O2/c1-16(19-7-21(29(30,31)32)12-22(33)8-19)34-28-25-10-18(5-6-26(25)35-17(2)36-28)20-9-23-13-24(37(3)4)14-38(23)27(11-20)40-15-39/h5-16H,33H2,1-4H3,(H,34,35,36)/t16-/m1/s1 |
| InChIKey | SKBVDUBMUHMHLT-MRXNPFEDSA-N |
| XLogP | 6.23 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|