C28H26F3N7O3 — CID 168867451
6-[2-(dimethylamino)-7-methoxyimidazo[1,2-a]pyridin-5-yl]-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 168867451) has the molecular formula C28H26F3N7O3 and a molecular weight of 565.56 g/mol. Its IUPAC name is 6-[2-(dimethylamino)-7-methoxyimidazo[1,2-a]pyridin-5-yl]-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 6-[2-(dimethylamino)-7-methoxyimidazo[1,2-a]pyridin-5-yl]-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 168867451 |
| Molecular Formula | C28H26F3N7O3 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 6-[2-(dimethylamino)-7-methoxyimidazo[1,2-a]pyridin-5-yl]-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | COc1cc(-c2ccc3nc(C)nc(N[C@H](C)c4cc([N+](=O)[O-])cc(C(F)(F)F)c4)c3c2)n2cc(N(C)C)nc2c1 |
| InChI | InChI=1S/C28H26F3N7O3/c1-15(18-8-19(28(29,30)31)11-20(9-18)38(39)40)32-27-22-10-17(6-7-23(22)33-16(2)34-27)24-12-21(41-5)13-25-35-26(36(3)4)14-37(24)25/h6-15H,1-5H3,(H,32,33,34)/t15-/m1/s1 |
| InChIKey | IAOZMCKCXJAVHR-OAHLLOKOSA-N |
| XLogP | 6.43 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|