C26H24F3N5O3 — CID 142383030
5-[2,7-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]-1-ethylpyridin-2-one (PubChem CID 142383030) has the molecular formula C26H24F3N5O3 and a molecular weight of 511.50 g/mol. Its IUPAC name is 5-[2,7-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]-1-ethylpyridin-2-one.
| Compound Name | 5-[2,7-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 142383030 |
| Molecular Formula | C26H24F3N5O3 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 5-[2,7-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]quinazolin-6-yl]-1-ethylpyridin-2-one |
| SMILES | CCn1cc(-c2cc3c(N[C@H](C)c4cc([N+](=O)[O-])cc(C(F)(F)F)c4)nc(C)nc3cc2C)ccc1=O |
| InChI | InChI=1S/C26H24F3N5O3/c1-5-33-13-17(6-7-24(33)35)21-12-22-23(8-14(21)2)31-16(4)32-25(22)30-15(3)18-9-19(26(27,28)29)11-20(10-18)34(36)37/h6-13,15H,5H2,1-4H3,(H,30,31,32)/t15-/m1/s1 |
| InChIKey | XYWUPOZNRGBTFJ-OAHLLOKOSA-N |
| XLogP | 6.20 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|