C24H20F3N5O4 — CID 175266203
2-methyl-6-(1-methyl-2-oxo-4-pyridinyl)-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]phthalazin-1-one (PubChem CID 175266203) has the molecular formula C24H20F3N5O4 and a molecular weight of 499.45 g/mol. Its IUPAC name is 2-methyl-6-(1-methyl-2-oxo-4-pyridinyl)-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]phthalazin-1-one.
| Compound Name | 2-methyl-6-(1-methyl-2-oxo-4-pyridinyl)-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]phthalazin-1-one |
|---|---|
| PubChem CID | 175266203 |
| Molecular Formula | C24H20F3N5O4 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 2-methyl-6-(1-methyl-2-oxo-4-pyridinyl)-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]phthalazin-1-one |
| SMILES | CC(Nc1nn(C)c(=O)c2ccc(-c3ccn(C)c(=O)c3)cc12)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F3N5O4/c1-13(16-8-17(24(25,26)27)12-18(9-16)32(35)36)28-22-20-10-14(15-6-7-30(2)21(33)11-15)4-5-19(20)23(34)31(3)29-22/h4-13H,1-3H3,(H,28,29) |
| InChIKey | NVUMQEQZDKLVHC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|