C24H22F3N5O5 — CID 175498908
4-[1-methyl-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]-2-oxoquinazolin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 175498908) has the molecular formula C24H22F3N5O5 and a molecular weight of 517.46 g/mol. Its IUPAC name is 4-[1-methyl-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]-2-oxoquinazolin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[1-methyl-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]-2-oxoquinazolin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175498908 |
| Molecular Formula | C24H22F3N5O5 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 4-[1-methyl-4-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]-2-oxoquinazolin-6-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CC(Nc1nc(=O)n(C)c2ccc(C3=CCN(C(=O)O)CC3)cc12)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F3N5O5/c1-13(16-9-17(24(25,26)27)12-18(10-16)32(36)37)28-21-19-11-15(3-4-20(19)30(2)22(33)29-21)14-5-7-31(8-6-14)23(34)35/h3-5,9-13H,6-8H2,1-2H3,(H,34,35)(H,28,29,33) |
| InChIKey | YOWRGCQZZJDXQM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|