C18H15BrF3N5O3 — CID 165179302
6-bromo-2,8-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 165179302) has the molecular formula C18H15BrF3N5O3 and a molecular weight of 486.25 g/mol. Its IUPAC name is 6-bromo-2,8-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-bromo-2,8-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 165179302 |
| Molecular Formula | C18H15BrF3N5O3 |
| Molecular Weight | 486.25 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | 6-bromo-2,8-dimethyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(Br)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C18H15BrF3N5O3/c1-8(10-4-11(18(20,21)22)6-12(5-10)27(29)30)23-15-13-7-14(19)17(28)26(3)16(13)25-9(2)24-15/h4-8H,1-3H3,(H,23,24,25)/t8-/m1/s1 |
| InChIKey | XSRIOZWYHUMEMP-MRVPVSSYSA-N |
| XLogP | 4.50 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|