C21H24F3N5O4 — CID 162513095
tert-butyl 2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 162513095) has the molecular formula C21H24F3N5O4 and a molecular weight of 467.45 g/mol. Its IUPAC name is tert-butyl 2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 162513095 |
| Molecular Formula | C21H24F3N5O4 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | tert-butyl 2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | Cc1nc2c(c(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)n1)CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C21H24F3N5O4/c1-11(13-6-14(21(22,23)24)8-15(7-13)29(31)32)25-18-16-9-28(19(30)33-20(3,4)5)10-17(16)26-12(2)27-18/h6-8,11H,9-10H2,1-5H3,(H,25,26,27)/t11-/m1/s1 |
| InChIKey | UAKSYXGYFIOVBG-LLVKDONJSA-N |
| XLogP | 5.14 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|