C29H31F3N8O4 — CID 172700966
tert-butyl 4-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-6-yl]pyrazole-1-carboxylate (PubChem CID 172700966) has the molecular formula C29H31F3N8O4 and a molecular weight of 612.61 g/mol. Its IUPAC name is tert-butyl 4-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-6-yl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-6-yl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 172700966 |
| Molecular Formula | C29H31F3N8O4 |
| Molecular Weight | 612.61 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | tert-butyl 4-[2-methyl-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-7-pyrrolidin-1-ylpyrido[2,3-d]pyrimidin-6-yl]pyrazole-1-carboxylate |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(-c3cnn(C(=O)OC(C)(C)C)c3)c(N3CCCC3)nc2n1 |
| InChI | InChI=1S/C29H31F3N8O4/c1-16(18-10-20(29(30,31)32)12-21(11-18)40(42)43)34-24-23-13-22(19-14-33-39(15-19)27(41)44-28(3,4)5)26(38-8-6-7-9-38)37-25(23)36-17(2)35-24/h10-16H,6-9H2,1-5H3,(H,34,35,36,37)/t16-/m1/s1 |
| InChIKey | CYOGFFAYQGKDQG-MRXNPFEDSA-N |
| XLogP | 6.68 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|