C17H12BrClF3N5O2 — CID 163365720
6-bromo-7-chloro-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 163365720) has the molecular formula C17H12BrClF3N5O2 and a molecular weight of 490.67 g/mol. Its IUPAC name is 6-bromo-7-chloro-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-bromo-7-chloro-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163365720 |
| Molecular Formula | C17H12BrClF3N5O2 |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 6-bromo-7-chloro-2-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(Br)c(Cl)nc2n1 |
| InChI | InChI=1S/C17H12BrClF3N5O2/c1-7(9-3-10(17(20,21)22)5-11(4-9)27(28)29)23-15-12-6-13(18)14(19)26-16(12)25-8(2)24-15/h3-7H,1-2H3,(H,23,24,25,26)/t7-/m1/s1 |
| InChIKey | XQDKQPMCXZYJAA-SSDOTTSWSA-N |
| XLogP | 5.85 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|