C17H11BrClF3N4O2 — CID 170171216
3-bromo-7-chloro-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-1,6-naphthyridin-5-amine (PubChem CID 170171216) has the molecular formula C17H11BrClF3N4O2 and a molecular weight of 475.65 g/mol. Its IUPAC name is 3-bromo-7-chloro-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-1,6-naphthyridin-5-amine.
| Compound Name | 3-bromo-7-chloro-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-1,6-naphthyridin-5-amine |
|---|---|
| PubChem CID | 170171216 |
| Molecular Formula | C17H11BrClF3N4O2 |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | 3-bromo-7-chloro-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-1,6-naphthyridin-5-amine |
| SMILES | CC(Nc1nc(Cl)cc2ncc(Br)cc12)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11BrClF3N4O2/c1-8(9-2-10(17(20,21)22)4-12(3-9)26(27)28)24-16-13-5-11(18)7-23-14(13)6-15(19)25-16/h2-8H,1H3,(H,24,25) |
| InChIKey | IRVLWBCFJVGWRE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|