C14H11BrClF3N2 — CID 102715658
N-[1-(4-bromophenyl)ethyl]-6-chloro-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715658) has the molecular formula C14H11BrClF3N2 and a molecular weight of 379.61 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-6-chloro-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-6-chloro-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715658 |
| Molecular Formula | C14H11BrClF3N2 |
| Molecular Weight | 379.61 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-6-chloro-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(Nc1cc(C(F)(F)F)cc(Cl)n1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H11BrClF3N2/c1-8(9-2-4-11(15)5-3-9)20-13-7-10(14(17,18)19)6-12(16)21-13/h2-8H,1H3,(H,20,21) |
| InChIKey | RJCSKFXEOUGYAB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|