C14H14ClF3N2S — CID 102715652
6-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102715652) has the molecular formula C14H14ClF3N2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 6-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102715652 |
| Molecular Formula | C14H14ClF3N2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 6-chloro-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc(C(C)Nc2cc(C(F)(F)F)cc(Cl)n2)c(C)s1 |
| InChI | InChI=1S/C14H14ClF3N2S/c1-7-4-11(9(3)21-7)8(2)19-13-6-10(14(16,17)18)5-12(15)20-13/h4-6,8H,1-3H3,(H,19,20) |
| InChIKey | DDPDNIWYDCUALX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|