C10H10ClF3N2O2 — CID 97136425
methyl (2S)-2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate (PubChem CID 97136425) has the molecular formula C10H10ClF3N2O2 and a molecular weight of 282.65 g/mol. Its IUPAC name is methyl (2S)-2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
|---|---|
| PubChem CID | 97136425 |
| Molecular Formula | C10H10ClF3N2O2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | methyl (2S)-2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)Nc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C10H10ClF3N2O2/c1-5(9(17)18-2)15-8-4-6(10(12,13)14)3-7(11)16-8/h3-5H,1-2H3,(H,15,16)/t5-/m0/s1 |
| InChIKey | DFXRRTTXHWUNGX-YFKPBYRVSA-N |
| XLogP | 2.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|