C9H11ClN4O3 — CID 89422566
methyl (2S)-2-[(4-carbamoyl-6-chloropyrimidin-2-yl)amino]propanoate (PubChem CID 89422566) has the molecular formula C9H11ClN4O3 and a molecular weight of 258.66 g/mol. Its IUPAC name is methyl (2S)-2-[(4-carbamoyl-6-chloropyrimidin-2-yl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(4-carbamoyl-6-chloropyrimidin-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 89422566 |
| Molecular Formula | C9H11ClN4O3 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | methyl (2S)-2-[(4-carbamoyl-6-chloropyrimidin-2-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)Nc1nc(Cl)cc(C(N)=O)n1 |
| InChI | InChI=1S/C9H11ClN4O3/c1-4(8(16)17-2)12-9-13-5(7(11)15)3-6(10)14-9/h3-4H,1-2H3,(H2,11,15)(H,12,13,14)/t4-/m0/s1 |
| InChIKey | BGJFMUDOZIIMET-BYPYZUCNSA-N |
| XLogP | 0.20 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |