methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate

C9H10Cl2N2O2 — CID 43515153

IUPACmethyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate
SMILESCOC(=O)C(C)Nc1ncc(Cl)cc1Cl
InChIInChI=1S/C9H10Cl2N2O2/c1-5(9(14)15-2)13-8-7(11)3-6(10)4-12-8/h3-5H,1-2H3,(H,12,13)
InChIKeyIGSRNCALEFZKGW-UHFFFAOYSA-N
MW249.10 g/mol
LogP2.36
Rot. Bonds3

About methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate

methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate (PubChem CID 43515153) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate
PubChem CID43515153
Molecular FormulaC9H10Cl2N2O2
Molecular Weight249.10 g/mol
Exact Mass248.01
IUPAC Namemethyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate
SMILESCOC(=O)C(C)Nc1ncc(Cl)cc1Cl
InChIInChI=1S/C9H10Cl2N2O2/c1-5(9(14)15-2)13-8-7(11)3-6(10)4-12-8/h3-5H,1-2H3,(H,12,13)
InChIKeyIGSRNCALEFZKGW-UHFFFAOYSA-N
XLogP2.36
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.10
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate?
The IUPAC name of methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate (CID 43515153) is methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate.
What is the SMILES notation for methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate?
The canonical SMILES for methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate is COC(=O)C(C)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate?
The InChIKey is IGSRNCALEFZKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O2/c1-5(9(14)15-2)13-8-7(11)3-6(10)4-12-8/h3-5H,1-2H3,(H,12,13).
What are the key properties of methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate?
methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate has a molecular weight of 249.10 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dichloro-2-pyridinyl)amino]propanoate is sourced from PubChem (CID 43515153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).