C12H18Cl2N2 — CID 63925501
3,5-dichloro-N-(5-methylhexan-2-yl)pyridin-2-amine (PubChem CID 63925501) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 3,5-dichloro-N-(5-methylhexan-2-yl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(5-methylhexan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 63925501 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3,5-dichloro-N-(5-methylhexan-2-yl)pyridin-2-amine |
| SMILES | CC(C)CCC(C)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-8(2)4-5-9(3)16-12-11(14)6-10(13)7-15-12/h6-9H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | MDDMXBLEQXEPTG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |