C7H6Cl2N2OS — CID 87838372
S-methyl N-(3,5-dichloro-2-pyridinyl)carbamothioate (PubChem CID 87838372) has the molecular formula C7H6Cl2N2OS and a molecular weight of 237.11 g/mol. Its IUPAC name is S-methyl N-(3,5-dichloro-2-pyridinyl)carbamothioate.
| Compound Name | S-methyl N-(3,5-dichloro-2-pyridinyl)carbamothioate |
|---|---|
| PubChem CID | 87838372 |
| Molecular Formula | C7H6Cl2N2OS |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | S-methyl N-(3,5-dichloro-2-pyridinyl)carbamothioate |
| SMILES | CSC(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl2N2OS/c1-13-7(12)11-6-5(9)2-4(8)3-10-6/h2-3H,1H3,(H,10,11,12) |
| InChIKey | XVIRMWOUJDEHQB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|