About (3,5-dichloro-2-pyridinyl)hydrazine;hydrate
(3,5-dichloro-2-pyridinyl)hydrazine;hydrate (PubChem CID 175331134) has the molecular formula C5H7Cl2N3O
and a molecular weight of 196.04 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)hydrazine;hydrate.
Molecular Properties
| Compound Name | (3,5-dichloro-2-pyridinyl)hydrazine;hydrate |
| PubChem CID | 175331134 |
| Molecular Formula | C5H7Cl2N3O |
| Molecular Weight | 196.04 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)hydrazine;hydrate |
| SMILES | NNc1ncc(Cl)cc1Cl.O |
| InChI | InChI=1S/C5H5Cl2N3.H2O/c6-3-1-4(7)5(10-8)9-2-3;/h1-2H,8H2,(H,9,10);1H2 |
| InChIKey | FXNWNLYPBIRPRK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.04 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dichloro-2-pyridinyl)hydrazine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichloro-2-pyridinyl)hydrazine;hydrate?
The IUPAC name of (3,5-dichloro-2-pyridinyl)hydrazine;hydrate (CID 175331134) is (3,5-dichloro-2-pyridinyl)hydrazine;hydrate.
What is the SMILES notation for (3,5-dichloro-2-pyridinyl)hydrazine;hydrate?
The canonical SMILES for (3,5-dichloro-2-pyridinyl)hydrazine;hydrate is NNc1ncc(Cl)cc1Cl.O.
What is the InChIKey of (3,5-dichloro-2-pyridinyl)hydrazine;hydrate?
The InChIKey is FXNWNLYPBIRPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl2N3.H2O/c6-3-1-4(7)5(10-8)9-2-3;/h1-2H,8H2,(H,9,10);1H2.
What are the key properties of (3,5-dichloro-2-pyridinyl)hydrazine;hydrate?
(3,5-dichloro-2-pyridinyl)hydrazine;hydrate has a molecular weight of 196.04 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichloro-2-pyridinyl)hydrazine;hydrate is sourced from PubChem (CID 175331134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).