C5H7Cl2N3O — CID 175331134
(3,5-dichloro-2-pyridinyl)hydrazine;hydrate (PubChem CID 175331134) has the molecular formula C5H7Cl2N3O and a molecular weight of 196.04 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)hydrazine;hydrate.
| Compound Name | (3,5-dichloro-2-pyridinyl)hydrazine;hydrate |
|---|---|
| PubChem CID | 175331134 |
| Molecular Formula | C5H7Cl2N3O |
| Molecular Weight | 196.04 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)hydrazine;hydrate |
| SMILES | NNc1ncc(Cl)cc1Cl.O |
| InChI | InChI=1S/C5H5Cl2N3.H2O/c6-3-1-4(7)5(10-8)9-2-3;/h1-2H,8H2,(H,9,10);1H2 |
| InChIKey | FXNWNLYPBIRPRK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.04 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|