About 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride
3,5-dichloro-N-methylpyridin-2-amine;hydrochloride (PubChem CID 159350440) has the molecular formula C6H7Cl3N2
and a molecular weight of 213.50 g/mol. Its IUPAC name is 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride |
| PubChem CID | 159350440 |
| Molecular Formula | C6H7Cl3N2 |
| Molecular Weight | 213.50 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride |
| SMILES | CNc1ncc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C6H6Cl2N2.ClH/c1-9-6-5(8)2-4(7)3-10-6;/h2-3H,1H3,(H,9,10);1H |
| InChIKey | LHGKISUHTFWYCD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride?
The IUPAC name of 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride (CID 159350440) is 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride.
What is the SMILES notation for 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride?
The canonical SMILES for 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride is CNc1ncc(Cl)cc1Cl.Cl.
What is the InChIKey of 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride?
The InChIKey is LHGKISUHTFWYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2.ClH/c1-9-6-5(8)2-4(7)3-10-6;/h2-3H,1H3,(H,9,10);1H.
What are the key properties of 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride?
3,5-dichloro-N-methylpyridin-2-amine;hydrochloride has a molecular weight of 213.50 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride is sourced from PubChem (CID 159350440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).