C6H7Cl3N2 — CID 159350440
3,5-dichloro-N-methylpyridin-2-amine;hydrochloride (PubChem CID 159350440) has the molecular formula C6H7Cl3N2 and a molecular weight of 213.50 g/mol. Its IUPAC name is 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride.
| Compound Name | 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 159350440 |
| Molecular Formula | C6H7Cl3N2 |
| Molecular Weight | 213.50 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 3,5-dichloro-N-methylpyridin-2-amine;hydrochloride |
| SMILES | CNc1ncc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C6H6Cl2N2.ClH/c1-9-6-5(8)2-4(7)3-10-6;/h2-3H,1H3,(H,9,10);1H |
| InChIKey | LHGKISUHTFWYCD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |