C10H12Cl4N2 — CID 107867329
3,5-dichloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]pyridin-2-amine (PubChem CID 107867329) has the molecular formula C10H12Cl4N2 and a molecular weight of 302.03 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 107867329 |
| Molecular Formula | C10H12Cl4N2 |
| Molecular Weight | 302.03 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 3,5-dichloro-N-[1-chloro-2-(chloromethyl)butan-2-yl]pyridin-2-amine |
| SMILES | CCC(CCl)(CCl)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl4N2/c1-2-10(5-11,6-12)16-9-8(14)3-7(13)4-15-9/h3-4H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | AYBSEKLABJVPPQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.03 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|