C11H16BrClN2 — CID 106329478
3-bromo-5-chloro-N-(3-methylpentan-3-yl)pyridin-2-amine (PubChem CID 106329478) has the molecular formula C11H16BrClN2 and a molecular weight of 291.62 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-(3-methylpentan-3-yl)pyridin-2-amine.
| Compound Name | 3-bromo-5-chloro-N-(3-methylpentan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 106329478 |
| Molecular Formula | C11H16BrClN2 |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 3-bromo-5-chloro-N-(3-methylpentan-3-yl)pyridin-2-amine |
| SMILES | CCC(C)(CC)Nc1ncc(Cl)cc1Br |
| InChI | InChI=1S/C11H16BrClN2/c1-4-11(3,5-2)15-10-9(12)6-8(13)7-14-10/h6-7H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | WUKUWKGVKCZSDE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |