About 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol
3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 106185235) has the molecular formula C11H16BrClN2O
and a molecular weight of 307.62 g/mol. Its IUPAC name is 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol |
| PubChem CID | 106185235 |
| Molecular Formula | C11H16BrClN2O |
| Molecular Weight | 307.62 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1ncc(Cl)cc1Br |
| InChI | InChI=1S/C11H16BrClN2O/c1-10(2,11(3,4)16)15-9-8(12)5-7(13)6-14-9/h5-6,16H,1-4H3,(H,14,15) |
| InChIKey | HIRFPSNPKIJJFX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol?
The IUPAC name of 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol (CID 106185235) is 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol?
The canonical SMILES for 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol is CC(C)(O)C(C)(C)Nc1ncc(Cl)cc1Br.
What is the InChIKey of 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol?
The InChIKey is HIRFPSNPKIJJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrClN2O/c1-10(2,11(3,4)16)15-9-8(12)5-7(13)6-14-9/h5-6,16H,1-4H3,(H,14,15).
What are the key properties of 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol?
3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol has a molecular weight of 307.62 g/mol, XLogP of 3.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-bromo-5-chloro-2-pyridinyl)amino]-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 106185235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).