C12H19Cl2N3 — CID 106251497
N'-(3,5-dichloro-2-pyridinyl)-2,2-diethylpropane-1,3-diamine (PubChem CID 106251497) has the molecular formula C12H19Cl2N3 and a molecular weight of 276.21 g/mol. Its IUPAC name is N'-(3,5-dichloro-2-pyridinyl)-2,2-diethylpropane-1,3-diamine.
| Compound Name | N'-(3,5-dichloro-2-pyridinyl)-2,2-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106251497 |
| Molecular Formula | C12H19Cl2N3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N'-(3,5-dichloro-2-pyridinyl)-2,2-diethylpropane-1,3-diamine |
| SMILES | CCC(CC)(CN)CNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H19Cl2N3/c1-3-12(4-2,7-15)8-17-11-10(14)5-9(13)6-16-11/h5-6H,3-4,7-8,15H2,1-2H3,(H,16,17) |
| InChIKey | PYXNPYBIFSZWEN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |