C9H13Cl2N3O — CID 63766858
N-[2-(2-aminoethoxy)ethyl]-3,5-dichloropyridin-2-amine (PubChem CID 63766858) has the molecular formula C9H13Cl2N3O and a molecular weight of 250.13 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-3,5-dichloropyridin-2-amine.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-3,5-dichloropyridin-2-amine |
|---|---|
| PubChem CID | 63766858 |
| Molecular Formula | C9H13Cl2N3O |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-3,5-dichloropyridin-2-amine |
| SMILES | NCCOCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H13Cl2N3O/c10-7-5-8(11)9(14-6-7)13-2-4-15-3-1-12/h5-6H,1-4,12H2,(H,13,14) |
| InChIKey | KQNJVMSMRJTZOK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|