C10H16BrN3O — CID 79717746
N-[2-(2-aminoethoxy)ethyl]-5-bromo-3-methylpyridin-2-amine (PubChem CID 79717746) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-5-bromo-3-methylpyridin-2-amine.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-5-bromo-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 79717746 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-5-bromo-3-methylpyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1NCCOCCN |
| InChI | InChI=1S/C10H16BrN3O/c1-8-6-9(11)7-14-10(8)13-3-5-15-4-2-12/h6-7H,2-5,12H2,1H3,(H,13,14) |
| InChIKey | MVFQXEJIWFJFKE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|