C9H14BrN3 — CID 14397364
N'-(5-bromo-3-methyl-2-pyridinyl)propane-1,3-diamine (PubChem CID 14397364) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is N'-(5-bromo-3-methyl-2-pyridinyl)propane-1,3-diamine.
| Compound Name | N'-(5-bromo-3-methyl-2-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 14397364 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N'-(5-bromo-3-methyl-2-pyridinyl)propane-1,3-diamine |
| SMILES | Cc1cc(Br)cnc1NCCCN |
| InChI | InChI=1S/C9H14BrN3/c1-7-5-8(10)6-13-9(7)12-4-2-3-11/h5-6H,2-4,11H2,1H3,(H,12,13) |
| InChIKey | FZBIPRAFLGSQNV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|