C12H15BrN4 — CID 112697448
5-bromo-3-methyl-N-(3-pyrazol-1-ylpropyl)pyridin-2-amine (PubChem CID 112697448) has the molecular formula C12H15BrN4 and a molecular weight of 295.18 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(3-pyrazol-1-ylpropyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-methyl-N-(3-pyrazol-1-ylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 112697448 |
| Molecular Formula | C12H15BrN4 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 5-bromo-3-methyl-N-(3-pyrazol-1-ylpropyl)pyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1NCCCn1cccn1 |
| InChI | InChI=1S/C12H15BrN4/c1-10-8-11(13)9-15-12(10)14-4-2-6-17-7-3-5-16-17/h3,5,7-9H,2,4,6H2,1H3,(H,14,15) |
| InChIKey | AZBRZKLGGDEZCX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|