C13H19Cl2N3O — CID 63869864
N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dichloropyridin-2-amine (PubChem CID 63869864) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dichloropyridin-2-amine.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dichloropyridin-2-amine |
|---|---|
| PubChem CID | 63869864 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-3,5-dichloropyridin-2-amine |
| SMILES | NC1CCC(OCCNc2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H19Cl2N3O/c14-9-7-12(15)13(18-8-9)17-5-6-19-11-3-1-10(16)2-4-11/h7-8,10-11H,1-6,16H2,(H,17,18) |
| InChIKey | RAMFFRDKSPPHSU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|