C13H21ClN4O2 — CID 80752333
N-[2-(4-aminocyclohexyl)oxyethyl]-5-chloro-2-methoxypyrimidin-4-amine (PubChem CID 80752333) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-5-chloro-2-methoxypyrimidin-4-amine.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-5-chloro-2-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 80752333 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-5-chloro-2-methoxypyrimidin-4-amine |
| SMILES | COc1ncc(Cl)c(NCCOC2CCC(N)CC2)n1 |
| InChI | InChI=1S/C13H21ClN4O2/c1-19-13-17-8-11(14)12(18-13)16-6-7-20-10-4-2-9(15)3-5-10/h8-10H,2-7,15H2,1H3,(H,16,17,18) |
| InChIKey | ZIBHUPPHZPUFIC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|