C12H16Cl2N2O — CID 55261073
3,5-dichloro-N-(2-cyclopentyloxyethyl)pyridin-2-amine (PubChem CID 55261073) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-cyclopentyloxyethyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(2-cyclopentyloxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55261073 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3,5-dichloro-N-(2-cyclopentyloxyethyl)pyridin-2-amine |
| SMILES | Clc1cnc(NCCOC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O/c13-9-7-11(14)12(16-8-9)15-5-6-17-10-3-1-2-4-10/h7-8,10H,1-6H2,(H,15,16) |
| InChIKey | CYTCJZIAGICCKI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|