C8H10Cl2N2 — CID 30058037
3,5-dichloro-N-propylpyridin-2-amine (PubChem CID 30058037) has the molecular formula C8H10Cl2N2 and a molecular weight of 205.09 g/mol. Its IUPAC name is 3,5-dichloro-N-propylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 30058037 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 3,5-dichloro-N-propylpyridin-2-amine |
| SMILES | CCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10Cl2N2/c1-2-3-11-8-7(10)4-6(9)5-12-8/h4-5H,2-3H2,1H3,(H,11,12) |
| InChIKey | SAOZPRLPUHIFSG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |