C11H17Cl2N5 — CID 111063524
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-propylguanidine (PubChem CID 111063524) has the molecular formula C11H17Cl2N5 and a molecular weight of 290.20 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-propylguanidine.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111063524 |
| Molecular Formula | C11H17Cl2N5 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H17Cl2N5/c1-2-3-16-11(14)17-5-4-15-10-9(13)6-8(12)7-18-10/h6-7H,2-5H2,1H3,(H,15,18)(H3,14,16,17) |
| InChIKey | IEOLCZKRIHLLMJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|